C20H22F3NS — CID 167080859
1-[(4-methylsulfanylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]piperidine (PubChem CID 167080859) has the molecular formula C20H22F3NS and a molecular weight of 365.46 g/mol. Its IUPAC name is 1-[(4-methylsulfanylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]piperidine.
| Compound Name | 1-[(4-methylsulfanylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]piperidine |
|---|---|
| PubChem CID | 167080859 |
| Molecular Formula | C20H22F3NS |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 1-[(4-methylsulfanylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]piperidine |
| SMILES | CSc1ccc(CN2CCCC(c3ccc(C(F)(F)F)cc3)C2)cc1 |
| InChI | InChI=1S/C20H22F3NS/c1-25-19-10-4-15(5-11-19)13-24-12-2-3-17(14-24)16-6-8-18(9-7-16)20(21,22)23/h4-11,17H,2-3,12-14H2,1H3 |
| InChIKey | JTDHCITUESFQCR-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |