C19H21ClF3N — CID 3049036
1-benzyl-3-[3-(trifluoromethyl)phenyl]piperidine;hydrochloride (PubChem CID 3049036) has the molecular formula C19H21ClF3N and a molecular weight of 355.83 g/mol. Its IUPAC name is 1-benzyl-3-[3-(trifluoromethyl)phenyl]piperidine;hydrochloride.
| Compound Name | 1-benzyl-3-[3-(trifluoromethyl)phenyl]piperidine;hydrochloride |
|---|---|
| PubChem CID | 3049036 |
| Molecular Formula | C19H21ClF3N |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 1-benzyl-3-[3-(trifluoromethyl)phenyl]piperidine;hydrochloride |
| SMILES | Cl.FC(F)(F)c1cccc(C2CCCN(Cc3ccccc3)C2)c1 |
| InChI | InChI=1S/C19H20F3N.ClH/c20-19(21,22)18-10-4-8-16(12-18)17-9-5-11-23(14-17)13-15-6-2-1-3-7-15;/h1-4,6-8,10,12,17H,5,9,11,13-14H2;1H |
| InChIKey | AQZIMFXVNAIZRY-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |