C20H22F3NO — CID 110535914
1-benzyl-3-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-ol (PubChem CID 110535914) has the molecular formula C20H22F3NO and a molecular weight of 349.40 g/mol. Its IUPAC name is 1-benzyl-3-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-ol.
| Compound Name | 1-benzyl-3-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 110535914 |
| Molecular Formula | C20H22F3NO |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 1-benzyl-3-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-ol |
| SMILES | OC1CCN(Cc2ccccc2)CC1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H22F3NO/c21-20(22,23)18-8-4-7-16(12-18)11-17-14-24(10-9-19(17)25)13-15-5-2-1-3-6-15/h1-8,12,17,19,25H,9-11,13-14H2 |
| InChIKey | JRLDFKUBNFKQMQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |