C20H19ClF3NO — CID 121146514
[3-(4-chlorophenyl)azepan-1-yl]-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 121146514) has the molecular formula C20H19ClF3NO and a molecular weight of 381.83 g/mol. Its IUPAC name is [3-(4-chlorophenyl)azepan-1-yl]-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [3-(4-chlorophenyl)azepan-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 121146514 |
| Molecular Formula | C20H19ClF3NO |
| Molecular Weight | 381.83 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | [3-(4-chlorophenyl)azepan-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1)N1CCCCC(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C20H19ClF3NO/c21-18-10-6-14(7-11-18)16-3-1-2-12-25(13-16)19(26)15-4-8-17(9-5-15)20(22,23)24/h4-11,16H,1-3,12-13H2 |
| InChIKey | UMFXJBMWKJLSJM-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.83 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |