C20H19ClF3NO2 — CID 46028668
(4-chlorophenyl)-[3-[[4-(trifluoromethyl)phenyl]methoxy]piperidin-1-yl]methanone (PubChem CID 46028668) has the molecular formula C20H19ClF3NO2 and a molecular weight of 397.82 g/mol. Its IUPAC name is (4-chlorophenyl)-[3-[[4-(trifluoromethyl)phenyl]methoxy]piperidin-1-yl]methanone.
| Compound Name | (4-chlorophenyl)-[3-[[4-(trifluoromethyl)phenyl]methoxy]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 46028668 |
| Molecular Formula | C20H19ClF3NO2 |
| Molecular Weight | 397.82 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | (4-chlorophenyl)-[3-[[4-(trifluoromethyl)phenyl]methoxy]piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Cl)cc1)N1CCCC(OCc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C20H19ClF3NO2/c21-17-9-5-15(6-10-17)19(26)25-11-1-2-18(12-25)27-13-14-3-7-16(8-4-14)20(22,23)24/h3-10,18H,1-2,11-13H2 |
| InChIKey | GUQSYZRUQARBJF-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.82 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |