C20H19ClF3NO3 — CID 93223787
(4-chlorophenyl)-[(3S)-3-[[3-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]methanone (PubChem CID 93223787) has the molecular formula C20H19ClF3NO3 and a molecular weight of 413.82 g/mol. Its IUPAC name is (4-chlorophenyl)-[(3S)-3-[[3-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]methanone.
| Compound Name | (4-chlorophenyl)-[(3S)-3-[[3-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 93223787 |
| Molecular Formula | C20H19ClF3NO3 |
| Molecular Weight | 413.82 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | (4-chlorophenyl)-[(3S)-3-[[3-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Cl)cc1)N1CCC[C@H](OCc2cccc(OC(F)(F)F)c2)C1 |
| InChI | InChI=1S/C20H19ClF3NO3/c21-16-8-6-15(7-9-16)19(26)25-10-2-5-18(12-25)27-13-14-3-1-4-17(11-14)28-20(22,23)24/h1,3-4,6-9,11,18H,2,5,10,12-13H2/t18-/m0/s1 |
| InChIKey | RYQFOWZBGSZOGL-SFHVURJKSA-N |
| XLogP | 5.06 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.82 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |