C20H19BrF3NO3 — CID 46029016
(3-bromophenyl)-[3-[[4-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]methanone (PubChem CID 46029016) has the molecular formula C20H19BrF3NO3 and a molecular weight of 458.27 g/mol. Its IUPAC name is (3-bromophenyl)-[3-[[4-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]methanone.
| Compound Name | (3-bromophenyl)-[3-[[4-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 46029016 |
| Molecular Formula | C20H19BrF3NO3 |
| Molecular Weight | 458.27 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | (3-bromophenyl)-[3-[[4-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]methanone |
| SMILES | O=C(c1cccc(Br)c1)N1CCCC(OCc2ccc(OC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C20H19BrF3NO3/c21-16-4-1-3-15(11-16)19(26)25-10-2-5-18(12-25)27-13-14-6-8-17(9-7-14)28-20(22,23)24/h1,3-4,6-9,11,18H,2,5,10,12-13H2 |
| InChIKey | WPCDQRFTSNQVON-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.27 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |