C17H16F3N3O3 — CID 122257463
(3-pyrimidin-2-yloxypiperidin-1-yl)-[3-(trifluoromethoxy)phenyl]methanone (PubChem CID 122257463) has the molecular formula C17H16F3N3O3 and a molecular weight of 367.33 g/mol. Its IUPAC name is (3-pyrimidin-2-yloxypiperidin-1-yl)-[3-(trifluoromethoxy)phenyl]methanone.
| Compound Name | (3-pyrimidin-2-yloxypiperidin-1-yl)-[3-(trifluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 122257463 |
| Molecular Formula | C17H16F3N3O3 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | (3-pyrimidin-2-yloxypiperidin-1-yl)-[3-(trifluoromethoxy)phenyl]methanone |
| SMILES | O=C(c1cccc(OC(F)(F)F)c1)N1CCCC(Oc2ncccn2)C1 |
| InChI | InChI=1S/C17H16F3N3O3/c18-17(19,20)26-13-5-1-4-12(10-13)15(24)23-9-2-6-14(11-23)25-16-21-7-3-8-22-16/h1,3-5,7-8,10,14H,2,6,9,11H2 |
| InChIKey | GCQHLAOAPLHTSE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |