C18H18F3N3O4 — CID 122261504
[3-(2-methoxypyrimidin-4-yl)oxypiperidin-1-yl]-[3-(trifluoromethoxy)phenyl]methanone (PubChem CID 122261504) has the molecular formula C18H18F3N3O4 and a molecular weight of 397.35 g/mol. Its IUPAC name is [3-(2-methoxypyrimidin-4-yl)oxypiperidin-1-yl]-[3-(trifluoromethoxy)phenyl]methanone.
| Compound Name | [3-(2-methoxypyrimidin-4-yl)oxypiperidin-1-yl]-[3-(trifluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 122261504 |
| Molecular Formula | C18H18F3N3O4 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | [3-(2-methoxypyrimidin-4-yl)oxypiperidin-1-yl]-[3-(trifluoromethoxy)phenyl]methanone |
| SMILES | COc1nccc(OC2CCCN(C(=O)c3cccc(OC(F)(F)F)c3)C2)n1 |
| InChI | InChI=1S/C18H18F3N3O4/c1-26-17-22-8-7-15(23-17)27-14-6-3-9-24(11-14)16(25)12-4-2-5-13(10-12)28-18(19,20)21/h2,4-5,7-8,10,14H,3,6,9,11H2,1H3 |
| InChIKey | SESBXWYBEOTSCS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |