C18H18F3N3O3 — CID 122260897
[3-(2-methylpyrimidin-4-yl)oxypiperidin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone (PubChem CID 122260897) has the molecular formula C18H18F3N3O3 and a molecular weight of 381.35 g/mol. Its IUPAC name is [3-(2-methylpyrimidin-4-yl)oxypiperidin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone.
| Compound Name | [3-(2-methylpyrimidin-4-yl)oxypiperidin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 122260897 |
| Molecular Formula | C18H18F3N3O3 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | [3-(2-methylpyrimidin-4-yl)oxypiperidin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone |
| SMILES | Cc1nccc(OC2CCCN(C(=O)c3ccc(OC(F)(F)F)cc3)C2)n1 |
| InChI | InChI=1S/C18H18F3N3O3/c1-12-22-9-8-16(23-12)26-15-3-2-10-24(11-15)17(25)13-4-6-14(7-5-13)27-18(19,20)21/h4-9,15H,2-3,10-11H2,1H3 |
| InChIKey | MBTCOSSESPHHGC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |