C15H17N5O2 — CID 122260865
[3-(2-methylpyrimidin-4-yl)oxypiperidin-1-yl]-pyrazin-2-ylmethanone (PubChem CID 122260865) has the molecular formula C15H17N5O2 and a molecular weight of 299.33 g/mol. Its IUPAC name is [3-(2-methylpyrimidin-4-yl)oxypiperidin-1-yl]-pyrazin-2-ylmethanone.
| Compound Name | [3-(2-methylpyrimidin-4-yl)oxypiperidin-1-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 122260865 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | [3-(2-methylpyrimidin-4-yl)oxypiperidin-1-yl]-pyrazin-2-ylmethanone |
| SMILES | Cc1nccc(OC2CCCN(C(=O)c3cnccn3)C2)n1 |
| InChI | InChI=1S/C15H17N5O2/c1-11-17-5-4-14(19-11)22-12-3-2-8-20(10-12)15(21)13-9-16-6-7-18-13/h4-7,9,12H,2-3,8,10H2,1H3 |
| InChIKey | CNVCQJTWWCOOQG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 81.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |