C15H16N4O3 — CID 122257432
(1-oxidopyridin-1-ium-3-yl)-(3-pyrimidin-2-yloxypiperidin-1-yl)methanone (PubChem CID 122257432) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is (1-oxidopyridin-1-ium-3-yl)-(3-pyrimidin-2-yloxypiperidin-1-yl)methanone.
| Compound Name | (1-oxidopyridin-1-ium-3-yl)-(3-pyrimidin-2-yloxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 122257432 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | (1-oxidopyridin-1-ium-3-yl)-(3-pyrimidin-2-yloxypiperidin-1-yl)methanone |
| SMILES | O=C(c1ccc[n+]([O-])c1)N1CCCC(Oc2ncccn2)C1 |
| InChI | InChI=1S/C15H16N4O3/c20-14(12-4-1-9-19(21)10-12)18-8-2-5-13(11-18)22-15-16-6-3-7-17-15/h1,3-4,6-7,9-10,13H,2,5,8,11H2 |
| InChIKey | IHDFEGICWBLXRS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 82.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|