C21H22F3NO3 — CID 42844188
2-phenyl-1-[3-[[3-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]ethanone (PubChem CID 42844188) has the molecular formula C21H22F3NO3 and a molecular weight of 393.40 g/mol. Its IUPAC name is 2-phenyl-1-[3-[[3-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]ethanone.
| Compound Name | 2-phenyl-1-[3-[[3-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 42844188 |
| Molecular Formula | C21H22F3NO3 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 2-phenyl-1-[3-[[3-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]ethanone |
| SMILES | O=C(Cc1ccccc1)N1CCCC(OCc2cccc(OC(F)(F)F)c2)C1 |
| InChI | InChI=1S/C21H22F3NO3/c22-21(23,24)28-18-9-4-8-17(12-18)15-27-19-10-5-11-25(14-19)20(26)13-16-6-2-1-3-7-16/h1-4,6-9,12,19H,5,10-11,13-15H2 |
| InChIKey | ORDXAXLGMJHDNG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |