C16H20F3NO3 — CID 93223657
2-methoxy-1-[(3R)-3-[[3-(trifluoromethyl)phenyl]methoxy]piperidin-1-yl]ethanone (PubChem CID 93223657) has the molecular formula C16H20F3NO3 and a molecular weight of 331.33 g/mol. Its IUPAC name is 2-methoxy-1-[(3R)-3-[[3-(trifluoromethyl)phenyl]methoxy]piperidin-1-yl]ethanone.
| Compound Name | 2-methoxy-1-[(3R)-3-[[3-(trifluoromethyl)phenyl]methoxy]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 93223657 |
| Molecular Formula | C16H20F3NO3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 2-methoxy-1-[(3R)-3-[[3-(trifluoromethyl)phenyl]methoxy]piperidin-1-yl]ethanone |
| SMILES | COCC(=O)N1CCC[C@@H](OCc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C16H20F3NO3/c1-22-11-15(21)20-7-3-6-14(9-20)23-10-12-4-2-5-13(8-12)16(17,18)19/h2,4-5,8,14H,3,6-7,9-11H2,1H3/t14-/m1/s1 |
| InChIKey | PAKHGVFTRRPCAD-CQSZACIVSA-N |
| XLogP | 2.86 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |