C20H21ClFNO3 — CID 42844150
2-(4-chlorophenoxy)-1-[3-[(3-fluorophenyl)methoxy]piperidin-1-yl]ethanone (PubChem CID 42844150) has the molecular formula C20H21ClFNO3 and a molecular weight of 377.84 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-1-[3-[(3-fluorophenyl)methoxy]piperidin-1-yl]ethanone.
| Compound Name | 2-(4-chlorophenoxy)-1-[3-[(3-fluorophenyl)methoxy]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 42844150 |
| Molecular Formula | C20H21ClFNO3 |
| Molecular Weight | 377.84 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 2-(4-chlorophenoxy)-1-[3-[(3-fluorophenyl)methoxy]piperidin-1-yl]ethanone |
| SMILES | O=C(COc1ccc(Cl)cc1)N1CCCC(OCc2cccc(F)c2)C1 |
| InChI | InChI=1S/C20H21ClFNO3/c21-16-6-8-18(9-7-16)26-14-20(24)23-10-2-5-19(12-23)25-13-15-3-1-4-17(22)11-15/h1,3-4,6-9,11,19H,2,5,10,12-14H2 |
| InChIKey | DWAIUEPSJUMJPQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.84 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |