C21H24ClNO4 — CID 93223599
2-(4-chlorophenoxy)-1-[(3S)-3-[(3-methoxyphenyl)methoxy]piperidin-1-yl]ethanone (PubChem CID 93223599) has the molecular formula C21H24ClNO4 and a molecular weight of 389.88 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-1-[(3S)-3-[(3-methoxyphenyl)methoxy]piperidin-1-yl]ethanone.
| Compound Name | 2-(4-chlorophenoxy)-1-[(3S)-3-[(3-methoxyphenyl)methoxy]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 93223599 |
| Molecular Formula | C21H24ClNO4 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 2-(4-chlorophenoxy)-1-[(3S)-3-[(3-methoxyphenyl)methoxy]piperidin-1-yl]ethanone |
| SMILES | COc1cccc(CO[C@H]2CCCN(C(=O)COc3ccc(Cl)cc3)C2)c1 |
| InChI | InChI=1S/C21H24ClNO4/c1-25-19-5-2-4-16(12-19)14-26-20-6-3-11-23(13-20)21(24)15-27-18-9-7-17(22)8-10-18/h2,4-5,7-10,12,20H,3,6,11,13-15H2,1H3/t20-/m0/s1 |
| InChIKey | CLPIEXONKKCOBI-FQEVSTJZSA-N |
| XLogP | 3.94 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |