C20H22FNO3 — CID 93223601
(2-fluorophenyl)-[(3S)-3-[(3-methoxyphenyl)methoxy]piperidin-1-yl]methanone (PubChem CID 93223601) has the molecular formula C20H22FNO3 and a molecular weight of 343.40 g/mol. Its IUPAC name is (2-fluorophenyl)-[(3S)-3-[(3-methoxyphenyl)methoxy]piperidin-1-yl]methanone.
| Compound Name | (2-fluorophenyl)-[(3S)-3-[(3-methoxyphenyl)methoxy]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 93223601 |
| Molecular Formula | C20H22FNO3 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (2-fluorophenyl)-[(3S)-3-[(3-methoxyphenyl)methoxy]piperidin-1-yl]methanone |
| SMILES | COc1cccc(CO[C@H]2CCCN(C(=O)c3ccccc3F)C2)c1 |
| InChI | InChI=1S/C20H22FNO3/c1-24-16-7-4-6-15(12-16)14-25-17-8-5-11-22(13-17)20(23)18-9-2-3-10-19(18)21/h2-4,6-7,9-10,12,17H,5,8,11,13-14H2,1H3/t17-/m0/s1 |
| InChIKey | LSAYDQGINVEOJI-KRWDZBQOSA-N |
| XLogP | 3.66 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |