C19H19ClFNO2 — CID 93223153
(2-chlorophenyl)-[(3S)-3-[(2-fluorophenyl)methoxy]piperidin-1-yl]methanone (PubChem CID 93223153) has the molecular formula C19H19ClFNO2 and a molecular weight of 347.82 g/mol. Its IUPAC name is (2-chlorophenyl)-[(3S)-3-[(2-fluorophenyl)methoxy]piperidin-1-yl]methanone.
| Compound Name | (2-chlorophenyl)-[(3S)-3-[(2-fluorophenyl)methoxy]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 93223153 |
| Molecular Formula | C19H19ClFNO2 |
| Molecular Weight | 347.82 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | (2-chlorophenyl)-[(3S)-3-[(2-fluorophenyl)methoxy]piperidin-1-yl]methanone |
| SMILES | O=C(c1ccccc1Cl)N1CCC[C@H](OCc2ccccc2F)C1 |
| InChI | InChI=1S/C19H19ClFNO2/c20-17-9-3-2-8-16(17)19(23)22-11-5-7-15(12-22)24-13-14-6-1-4-10-18(14)21/h1-4,6,8-10,15H,5,7,11-13H2/t15-/m0/s1 |
| InChIKey | JVIMZWZBTCPFDU-HNNXBMFYSA-N |
| XLogP | 4.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.82 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |