C19H19Cl2NO2 — CID 93223391
(2-chlorophenyl)-[(3R)-3-[(3-chlorophenyl)methoxy]piperidin-1-yl]methanone (PubChem CID 93223391) has the molecular formula C19H19Cl2NO2 and a molecular weight of 364.27 g/mol. Its IUPAC name is (2-chlorophenyl)-[(3R)-3-[(3-chlorophenyl)methoxy]piperidin-1-yl]methanone.
| Compound Name | (2-chlorophenyl)-[(3R)-3-[(3-chlorophenyl)methoxy]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 93223391 |
| Molecular Formula | C19H19Cl2NO2 |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | (2-chlorophenyl)-[(3R)-3-[(3-chlorophenyl)methoxy]piperidin-1-yl]methanone |
| SMILES | O=C(c1ccccc1Cl)N1CCC[C@@H](OCc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C19H19Cl2NO2/c20-15-6-3-5-14(11-15)13-24-16-7-4-10-22(12-16)19(23)17-8-1-2-9-18(17)21/h1-3,5-6,8-9,11,16H,4,7,10,12-13H2/t16-/m1/s1 |
| InChIKey | XJRSRMCFQOFMEL-MRXNPFEDSA-N |
| XLogP | 4.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |