C19H20ClFN2O2 — CID 93224006
(3R)-N-(3-chlorophenyl)-3-[(3-fluorophenyl)methoxy]piperidine-1-carboxamide (PubChem CID 93224006) has the molecular formula C19H20ClFN2O2 and a molecular weight of 362.83 g/mol. Its IUPAC name is (3R)-N-(3-chlorophenyl)-3-[(3-fluorophenyl)methoxy]piperidine-1-carboxamide.
| Compound Name | (3R)-N-(3-chlorophenyl)-3-[(3-fluorophenyl)methoxy]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 93224006 |
| Molecular Formula | C19H20ClFN2O2 |
| Molecular Weight | 362.83 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | (3R)-N-(3-chlorophenyl)-3-[(3-fluorophenyl)methoxy]piperidine-1-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)N1CCC[C@@H](OCc2cccc(F)c2)C1 |
| InChI | InChI=1S/C19H20ClFN2O2/c20-15-5-2-7-17(11-15)22-19(24)23-9-3-8-18(12-23)25-13-14-4-1-6-16(21)10-14/h1-2,4-7,10-11,18H,3,8-9,12-13H2,(H,22,24)/t18-/m1/s1 |
| InChIKey | IDJZMNQMNQIKSR-GOSISDBHSA-N |
| XLogP | 4.69 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.83 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |