C19H20BrClN2O2 — CID 93224012
(3S)-3-[(4-bromophenyl)methoxy]-N-(3-chlorophenyl)piperidine-1-carboxamide (PubChem CID 93224012) has the molecular formula C19H20BrClN2O2 and a molecular weight of 423.74 g/mol. Its IUPAC name is (3S)-3-[(4-bromophenyl)methoxy]-N-(3-chlorophenyl)piperidine-1-carboxamide.
| Compound Name | (3S)-3-[(4-bromophenyl)methoxy]-N-(3-chlorophenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 93224012 |
| Molecular Formula | C19H20BrClN2O2 |
| Molecular Weight | 423.74 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | (3S)-3-[(4-bromophenyl)methoxy]-N-(3-chlorophenyl)piperidine-1-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)N1CCC[C@H](OCc2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C19H20BrClN2O2/c20-15-8-6-14(7-9-15)13-25-18-5-2-10-23(12-18)19(24)22-17-4-1-3-16(21)11-17/h1,3-4,6-9,11,18H,2,5,10,12-13H2,(H,22,24)/t18-/m0/s1 |
| InChIKey | PYZIBMWQPOUVLZ-SFHVURJKSA-N |
| XLogP | 5.32 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.74 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |