C19H20F2N2O2 — CID 46029181
3-[(2,5-difluorophenyl)methoxy]-N-phenylpiperidine-1-carboxamide (PubChem CID 46029181) has the molecular formula C19H20F2N2O2 and a molecular weight of 346.38 g/mol. Its IUPAC name is 3-[(2,5-difluorophenyl)methoxy]-N-phenylpiperidine-1-carboxamide.
| Compound Name | 3-[(2,5-difluorophenyl)methoxy]-N-phenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 46029181 |
| Molecular Formula | C19H20F2N2O2 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 3-[(2,5-difluorophenyl)methoxy]-N-phenylpiperidine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1)N1CCCC(OCc2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C19H20F2N2O2/c20-15-8-9-18(21)14(11-15)13-25-17-7-4-10-23(12-17)19(24)22-16-5-2-1-3-6-16/h1-3,5-6,8-9,11,17H,4,7,10,12-13H2,(H,22,24) |
| InChIKey | CLIIRNKYNQGJSV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |