C20H23FN2O2 — CID 93223962
(3S)-3-[(2-fluorophenyl)methoxy]-N-(4-methylphenyl)piperidine-1-carboxamide (PubChem CID 93223962) has the molecular formula C20H23FN2O2 and a molecular weight of 342.41 g/mol. Its IUPAC name is (3S)-3-[(2-fluorophenyl)methoxy]-N-(4-methylphenyl)piperidine-1-carboxamide.
| Compound Name | (3S)-3-[(2-fluorophenyl)methoxy]-N-(4-methylphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 93223962 |
| Molecular Formula | C20H23FN2O2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (3S)-3-[(2-fluorophenyl)methoxy]-N-(4-methylphenyl)piperidine-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCC[C@H](OCc3ccccc3F)C2)cc1 |
| InChI | InChI=1S/C20H23FN2O2/c1-15-8-10-17(11-9-15)22-20(24)23-12-4-6-18(13-23)25-14-16-5-2-3-7-19(16)21/h2-3,5,7-11,18H,4,6,12-14H2,1H3,(H,22,24)/t18-/m0/s1 |
| InChIKey | XUOOMTOWEQNJMO-SFHVURJKSA-N |
| XLogP | 4.35 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |