C20H19F4NO3 — CID 42844185
(2-fluorophenyl)-[3-[[4-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]methanone (PubChem CID 42844185) has the molecular formula C20H19F4NO3 and a molecular weight of 397.37 g/mol. Its IUPAC name is (2-fluorophenyl)-[3-[[4-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]methanone.
| Compound Name | (2-fluorophenyl)-[3-[[4-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 42844185 |
| Molecular Formula | C20H19F4NO3 |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | (2-fluorophenyl)-[3-[[4-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]methanone |
| SMILES | O=C(c1ccccc1F)N1CCCC(OCc2ccc(OC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C20H19F4NO3/c21-18-6-2-1-5-17(18)19(26)25-11-3-4-16(12-25)27-13-14-7-9-15(10-8-14)28-20(22,23)24/h1-2,5-10,16H,3-4,11-13H2 |
| InChIKey | WCMJTUVEGDLANX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |