C20H22BrNO3 — CID 93223609
(3-bromophenyl)-[(3S)-3-[(3-methoxyphenyl)methoxy]piperidin-1-yl]methanone (PubChem CID 93223609) has the molecular formula C20H22BrNO3 and a molecular weight of 404.30 g/mol. Its IUPAC name is (3-bromophenyl)-[(3S)-3-[(3-methoxyphenyl)methoxy]piperidin-1-yl]methanone.
| Compound Name | (3-bromophenyl)-[(3S)-3-[(3-methoxyphenyl)methoxy]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 93223609 |
| Molecular Formula | C20H22BrNO3 |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | (3-bromophenyl)-[(3S)-3-[(3-methoxyphenyl)methoxy]piperidin-1-yl]methanone |
| SMILES | COc1cccc(CO[C@H]2CCCN(C(=O)c3cccc(Br)c3)C2)c1 |
| InChI | InChI=1S/C20H22BrNO3/c1-24-18-8-2-5-15(11-18)14-25-19-9-4-10-22(13-19)20(23)16-6-3-7-17(21)12-16/h2-3,5-8,11-12,19H,4,9-10,13-14H2,1H3/t19-/m0/s1 |
| InChIKey | RVAWRDQABAUDJG-IBGZPJMESA-N |
| XLogP | 4.28 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |