C20H21Cl2NO3 — CID 46028843
2-(4-chlorophenoxy)-1-[3-[(2-chlorophenyl)methoxy]piperidin-1-yl]ethanone (PubChem CID 46028843) has the molecular formula C20H21Cl2NO3 and a molecular weight of 394.30 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-1-[3-[(2-chlorophenyl)methoxy]piperidin-1-yl]ethanone.
| Compound Name | 2-(4-chlorophenoxy)-1-[3-[(2-chlorophenyl)methoxy]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 46028843 |
| Molecular Formula | C20H21Cl2NO3 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 2-(4-chlorophenoxy)-1-[3-[(2-chlorophenyl)methoxy]piperidin-1-yl]ethanone |
| SMILES | O=C(COc1ccc(Cl)cc1)N1CCCC(OCc2ccccc2Cl)C1 |
| InChI | InChI=1S/C20H21Cl2NO3/c21-16-7-9-17(10-8-16)26-14-20(24)23-11-3-5-18(12-23)25-13-15-4-1-2-6-19(15)22/h1-2,4,6-10,18H,3,5,11-14H2 |
| InChIKey | CMQJALCDZKZOSM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |