C18H23F3N2O2 — CID 18456279
1-(4-cyclopentylpiperazin-1-yl)-2-[3-(trifluoromethoxy)phenyl]ethanone (PubChem CID 18456279) has the molecular formula C18H23F3N2O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is 1-(4-cyclopentylpiperazin-1-yl)-2-[3-(trifluoromethoxy)phenyl]ethanone.
| Compound Name | 1-(4-cyclopentylpiperazin-1-yl)-2-[3-(trifluoromethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 18456279 |
| Molecular Formula | C18H23F3N2O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 1-(4-cyclopentylpiperazin-1-yl)-2-[3-(trifluoromethoxy)phenyl]ethanone |
| SMILES | O=C(Cc1cccc(OC(F)(F)F)c1)N1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C18H23F3N2O2/c19-18(20,21)25-16-7-3-4-14(12-16)13-17(24)23-10-8-22(9-11-23)15-5-1-2-6-15/h3-4,7,12,15H,1-2,5-6,8-11,13H2 |
| InChIKey | TWVYQMSOTVIVSC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |