C21H21F3N4O3 — CID 178098716
5-amino-3-[(3S)-1-[2-[3-(trifluoromethoxy)phenyl]acetyl]piperidin-3-yl]-1H-benzimidazol-2-one (PubChem CID 178098716) has the molecular formula C21H21F3N4O3 and a molecular weight of 434.42 g/mol. Its IUPAC name is 5-amino-3-[(3S)-1-[2-[3-(trifluoromethoxy)phenyl]acetyl]piperidin-3-yl]-1H-benzimidazol-2-one.
| Compound Name | 5-amino-3-[(3S)-1-[2-[3-(trifluoromethoxy)phenyl]acetyl]piperidin-3-yl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 178098716 |
| Molecular Formula | C21H21F3N4O3 |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 5-amino-3-[(3S)-1-[2-[3-(trifluoromethoxy)phenyl]acetyl]piperidin-3-yl]-1H-benzimidazol-2-one |
| SMILES | Nc1ccc2[nH]c(=O)n([C@H]3CCCN(C(=O)Cc4cccc(OC(F)(F)F)c4)C3)c2c1 |
| InChI | InChI=1S/C21H21F3N4O3/c22-21(23,24)31-16-5-1-3-13(9-16)10-19(29)27-8-2-4-15(12-27)28-18-11-14(25)6-7-17(18)26-20(28)30/h1,3,5-7,9,11,15H,2,4,8,10,12,25H2,(H,26,30)/t15-/m0/s1 |
| InChIKey | OWZVEDQAOSGVOW-HNNXBMFYSA-N |
| XLogP | 3.22 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|