C22H23N3O5 — CID 178098619
3-[1-[2-(3-methoxyphenyl)acetyl]piperidin-3-yl]-2-oxo-1H-benzimidazole-5-carboxylic acid (PubChem CID 178098619) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is 3-[1-[2-(3-methoxyphenyl)acetyl]piperidin-3-yl]-2-oxo-1H-benzimidazole-5-carboxylic acid.
| Compound Name | 3-[1-[2-(3-methoxyphenyl)acetyl]piperidin-3-yl]-2-oxo-1H-benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 178098619 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 3-[1-[2-(3-methoxyphenyl)acetyl]piperidin-3-yl]-2-oxo-1H-benzimidazole-5-carboxylic acid |
| SMILES | COc1cccc(CC(=O)N2CCCC(n3c(=O)[nH]c4ccc(C(=O)O)cc43)C2)c1 |
| InChI | InChI=1S/C22H23N3O5/c1-30-17-6-2-4-14(10-17)11-20(26)24-9-3-5-16(13-24)25-19-12-15(21(27)28)7-8-18(19)23-22(25)29/h2,4,6-8,10,12,16H,3,5,9,11,13H2,1H3,(H,23,29)(H,27,28) |
| InChIKey | YPIIKNFJIPMWJW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 104.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |