C22H25N3O5 — CID 171678507
formic acid;3-[1-[2-(3-methoxyphenyl)acetyl]piperidin-4-yl]-1H-benzimidazol-2-one (PubChem CID 171678507) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is formic acid;3-[1-[2-(3-methoxyphenyl)acetyl]piperidin-4-yl]-1H-benzimidazol-2-one.
| Compound Name | formic acid;3-[1-[2-(3-methoxyphenyl)acetyl]piperidin-4-yl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 171678507 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | formic acid;3-[1-[2-(3-methoxyphenyl)acetyl]piperidin-4-yl]-1H-benzimidazol-2-one |
| SMILES | COc1cccc(CC(=O)N2CCC(n3c(=O)[nH]c4ccccc43)CC2)c1.O=CO |
| InChI | InChI=1S/C21H23N3O3.CH2O2/c1-27-17-6-4-5-15(13-17)14-20(25)23-11-9-16(10-12-23)24-19-8-3-2-7-18(19)22-21(24)26;2-1-3/h2-8,13,16H,9-12,14H2,1H3,(H,22,26);1H,(H,2,3) |
| InChIKey | KSLPIZAVCFEHPK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 104.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|