C20H20ClN3O2 — CID 172968181
6-chloro-3-[1-(2-phenylacetyl)piperidin-4-yl]-1H-benzimidazol-2-one (PubChem CID 172968181) has the molecular formula C20H20ClN3O2 and a molecular weight of 369.85 g/mol. Its IUPAC name is 6-chloro-3-[1-(2-phenylacetyl)piperidin-4-yl]-1H-benzimidazol-2-one.
| Compound Name | 6-chloro-3-[1-(2-phenylacetyl)piperidin-4-yl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 172968181 |
| Molecular Formula | C20H20ClN3O2 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 6-chloro-3-[1-(2-phenylacetyl)piperidin-4-yl]-1H-benzimidazol-2-one |
| SMILES | O=C(Cc1ccccc1)N1CCC(n2c(=O)[nH]c3cc(Cl)ccc32)CC1 |
| InChI | InChI=1S/C20H20ClN3O2/c21-15-6-7-18-17(13-15)22-20(26)24(18)16-8-10-23(11-9-16)19(25)12-14-4-2-1-3-5-14/h1-7,13,16H,8-12H2,(H,22,26) |
| InChIKey | DSIQSMOUZRAHFH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |