C17H16ClN3O3 — CID 172968093
6-chloro-3-[1-(furan-3-carbonyl)piperidin-4-yl]-1H-benzimidazol-2-one (PubChem CID 172968093) has the molecular formula C17H16ClN3O3 and a molecular weight of 345.79 g/mol. Its IUPAC name is 6-chloro-3-[1-(furan-3-carbonyl)piperidin-4-yl]-1H-benzimidazol-2-one.
| Compound Name | 6-chloro-3-[1-(furan-3-carbonyl)piperidin-4-yl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 172968093 |
| Molecular Formula | C17H16ClN3O3 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 6-chloro-3-[1-(furan-3-carbonyl)piperidin-4-yl]-1H-benzimidazol-2-one |
| SMILES | O=C(c1ccoc1)N1CCC(n2c(=O)[nH]c3cc(Cl)ccc32)CC1 |
| InChI | InChI=1S/C17H16ClN3O3/c18-12-1-2-15-14(9-12)19-17(23)21(15)13-3-6-20(7-4-13)16(22)11-5-8-24-10-11/h1-2,5,8-10,13H,3-4,6-7H2,(H,19,23) |
| InChIKey | ZWDQZCYHELHZNR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |