C19H24F3NO — CID 173110524
3-cyclopentyl-6-[2-[3-(trifluoromethoxy)phenyl]ethyl]-3-azabicyclo[3.1.0]hexane (PubChem CID 173110524) has the molecular formula C19H24F3NO and a molecular weight of 339.40 g/mol. Its IUPAC name is 3-cyclopentyl-6-[2-[3-(trifluoromethoxy)phenyl]ethyl]-3-azabicyclo[3.1.0]hexane.
| Compound Name | 3-cyclopentyl-6-[2-[3-(trifluoromethoxy)phenyl]ethyl]-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 173110524 |
| Molecular Formula | C19H24F3NO |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 3-cyclopentyl-6-[2-[3-(trifluoromethoxy)phenyl]ethyl]-3-azabicyclo[3.1.0]hexane |
| SMILES | FC(F)(F)Oc1cccc(CCC2C3CN(C4CCCC4)CC23)c1 |
| InChI | InChI=1S/C19H24F3NO/c20-19(21,22)24-15-7-3-4-13(10-15)8-9-16-17-11-23(12-18(16)17)14-5-1-2-6-14/h3-4,7,10,14,16-18H,1-2,5-6,8-9,11-12H2 |
| InChIKey | DJEGWIQZLTXXGV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |