C16H21F3N2O2S — CID 154830019
N-[1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]cyclopropanesulfonamide (PubChem CID 154830019) has the molecular formula C16H21F3N2O2S and a molecular weight of 362.42 g/mol. Its IUPAC name is N-[1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]cyclopropanesulfonamide.
| Compound Name | N-[1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 154830019 |
| Molecular Formula | C16H21F3N2O2S |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | N-[1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]cyclopropanesulfonamide |
| SMILES | O=S(=O)(NC1CCCN(Cc2ccc(C(F)(F)F)cc2)C1)C1CC1 |
| InChI | InChI=1S/C16H21F3N2O2S/c17-16(18,19)13-5-3-12(4-6-13)10-21-9-1-2-14(11-21)20-24(22,23)15-7-8-15/h3-6,14-15,20H,1-2,7-11H2 |
| InChIKey | ANWCGLSYDVKCOM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |