C20H23F3N2 — CID 95545419
4-[[(3S)-3-[2-[2-(trifluoromethyl)phenyl]ethyl]piperidin-1-yl]methyl]pyridine (PubChem CID 95545419) has the molecular formula C20H23F3N2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 4-[[(3S)-3-[2-[2-(trifluoromethyl)phenyl]ethyl]piperidin-1-yl]methyl]pyridine.
| Compound Name | 4-[[(3S)-3-[2-[2-(trifluoromethyl)phenyl]ethyl]piperidin-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 95545419 |
| Molecular Formula | C20H23F3N2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 4-[[(3S)-3-[2-[2-(trifluoromethyl)phenyl]ethyl]piperidin-1-yl]methyl]pyridine |
| SMILES | FC(F)(F)c1ccccc1CC[C@H]1CCCN(Cc2ccncc2)C1 |
| InChI | InChI=1S/C20H23F3N2/c21-20(22,23)19-6-2-1-5-18(19)8-7-16-4-3-13-25(14-16)15-17-9-11-24-12-10-17/h1-2,5-6,9-12,16H,3-4,7-8,13-15H2/t16-/m1/s1 |
| InChIKey | ULYZWVAGBKJAQQ-MRXNPFEDSA-N |
| XLogP | 4.95 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |