C20H24F3N3 — CID 95558692
3-[[(3S)-3-[2-[2-(trifluoromethyl)phenyl]ethyl]piperidin-1-yl]methyl]pyridin-2-amine (PubChem CID 95558692) has the molecular formula C20H24F3N3 and a molecular weight of 363.43 g/mol. Its IUPAC name is 3-[[(3S)-3-[2-[2-(trifluoromethyl)phenyl]ethyl]piperidin-1-yl]methyl]pyridin-2-amine.
| Compound Name | 3-[[(3S)-3-[2-[2-(trifluoromethyl)phenyl]ethyl]piperidin-1-yl]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 95558692 |
| Molecular Formula | C20H24F3N3 |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 3-[[(3S)-3-[2-[2-(trifluoromethyl)phenyl]ethyl]piperidin-1-yl]methyl]pyridin-2-amine |
| SMILES | Nc1ncccc1CN1CCC[C@H](CCc2ccccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C20H24F3N3/c21-20(22,23)18-8-2-1-6-16(18)10-9-15-5-4-12-26(13-15)14-17-7-3-11-25-19(17)24/h1-3,6-8,11,15H,4-5,9-10,12-14H2,(H2,24,25)/t15-/m1/s1 |
| InChIKey | PZKBWJPOMOBVJX-OAHLLOKOSA-N |
| XLogP | 4.53 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |