C13H18ClF3N2 — CID 119909959
1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-3-amine;hydrochloride (PubChem CID 119909959) has the molecular formula C13H18ClF3N2 and a molecular weight of 294.75 g/mol. Its IUPAC name is 1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-3-amine;hydrochloride.
| Compound Name | 1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119909959 |
| Molecular Formula | C13H18ClF3N2 |
| Molecular Weight | 294.75 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-3-amine;hydrochloride |
| SMILES | Cl.NC1CCCN(Cc2ccccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C13H17F3N2.ClH/c14-13(15,16)12-6-2-1-4-10(12)8-18-7-3-5-11(17)9-18;/h1-2,4,6,11H,3,5,7-9,17H2;1H |
| InChIKey | VMNLSGYKIZPMHM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.75 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |