C12H17BrN2 — CID 24904438
(3S)-1-[(2-bromophenyl)methyl]piperidin-3-amine (PubChem CID 24904438) has the molecular formula C12H17BrN2 and a molecular weight of 269.19 g/mol. Its IUPAC name is (3S)-1-[(2-bromophenyl)methyl]piperidin-3-amine.
| Compound Name | (3S)-1-[(2-bromophenyl)methyl]piperidin-3-amine |
|---|---|
| PubChem CID | 24904438 |
| Molecular Formula | C12H17BrN2 |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | (3S)-1-[(2-bromophenyl)methyl]piperidin-3-amine |
| SMILES | N[C@H]1CCCN(Cc2ccccc2Br)C1 |
| InChI | InChI=1S/C12H17BrN2/c13-12-6-2-1-4-10(12)8-15-7-3-5-11(14)9-15/h1-2,4,6,11H,3,5,7-9,14H2/t11-/m0/s1 |
| InChIKey | YSEBLSWFGARBGE-NSHDSACASA-N |
| XLogP | 2.37 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |