C12H17BrClFN2 — CID 119910188
1-[(2-bromo-5-fluorophenyl)methyl]piperidin-3-amine;hydrochloride (PubChem CID 119910188) has the molecular formula C12H17BrClFN2 and a molecular weight of 323.64 g/mol. Its IUPAC name is 1-[(2-bromo-5-fluorophenyl)methyl]piperidin-3-amine;hydrochloride.
| Compound Name | 1-[(2-bromo-5-fluorophenyl)methyl]piperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119910188 |
| Molecular Formula | C12H17BrClFN2 |
| Molecular Weight | 323.64 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 1-[(2-bromo-5-fluorophenyl)methyl]piperidin-3-amine;hydrochloride |
| SMILES | Cl.NC1CCCN(Cc2cc(F)ccc2Br)C1 |
| InChI | InChI=1S/C12H16BrFN2.ClH/c13-12-4-3-10(14)6-9(12)7-16-5-1-2-11(15)8-16;/h3-4,6,11H,1-2,5,7-8,15H2;1H |
| InChIKey | AURVTXHHQVGJAY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.64 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |