C16H19F3N2O4 — CID 69068497
(E)-but-2-enedioic acid;1-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-amine (PubChem CID 69068497) has the molecular formula C16H19F3N2O4 and a molecular weight of 360.33 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-amine.
| Compound Name | (E)-but-2-enedioic acid;1-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 69068497 |
| Molecular Formula | C16H19F3N2O4 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (E)-but-2-enedioic acid;1-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-amine |
| SMILES | NC1CCN(Cc2ccccc2C(F)(F)F)C1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C12H15F3N2.C4H4O4/c13-12(14,15)11-4-2-1-3-9(11)7-17-6-5-10(16)8-17;5-3(6)1-2-4(7)8/h1-4,10H,5-8,16H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | LQOKCBZVDFHMHO-WLHGVMLRSA-N |
| XLogP | 1.95 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|