C13H17Cl2F3N2 — CID 119034117
1-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]piperidin-3-amine;hydrochloride (PubChem CID 119034117) has the molecular formula C13H17Cl2F3N2 and a molecular weight of 329.19 g/mol. Its IUPAC name is 1-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]piperidin-3-amine;hydrochloride.
| Compound Name | 1-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]piperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119034117 |
| Molecular Formula | C13H17Cl2F3N2 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 1-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]piperidin-3-amine;hydrochloride |
| SMILES | Cl.NC1CCCN(Cc2ccc(Cl)c(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C13H16ClF3N2.ClH/c14-12-4-3-9(6-11(12)13(15,16)17)7-19-5-1-2-10(18)8-19;/h3-4,6,10H,1-2,5,7-8,18H2;1H |
| InChIKey | PIXXKNUEKQKEMN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |