C17H20F3N3 — CID 96575360
(3S)-3-(1-methylimidazol-2-yl)-1-[[2-(trifluoromethyl)phenyl]methyl]piperidine (PubChem CID 96575360) has the molecular formula C17H20F3N3 and a molecular weight of 323.36 g/mol. Its IUPAC name is (3S)-3-(1-methylimidazol-2-yl)-1-[[2-(trifluoromethyl)phenyl]methyl]piperidine.
| Compound Name | (3S)-3-(1-methylimidazol-2-yl)-1-[[2-(trifluoromethyl)phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 96575360 |
| Molecular Formula | C17H20F3N3 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | (3S)-3-(1-methylimidazol-2-yl)-1-[[2-(trifluoromethyl)phenyl]methyl]piperidine |
| SMILES | Cn1ccnc1[C@H]1CCCN(Cc2ccccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C17H20F3N3/c1-22-10-8-21-16(22)14-6-4-9-23(12-14)11-13-5-2-3-7-15(13)17(18,19)20/h2-3,5,7-8,10,14H,4,6,9,11-12H2,1H3/t14-/m0/s1 |
| InChIKey | UYNNBVOHUZHBAS-AWEZNQCLSA-N |
| XLogP | 3.82 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |