C18H20F3N3O — CID 136782802
2-methyl-4-[(3S)-1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]-1H-pyrimidin-6-one (PubChem CID 136782802) has the molecular formula C18H20F3N3O and a molecular weight of 351.37 g/mol. Its IUPAC name is 2-methyl-4-[(3S)-1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]-1H-pyrimidin-6-one.
| Compound Name | 2-methyl-4-[(3S)-1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136782802 |
| Molecular Formula | C18H20F3N3O |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 2-methyl-4-[(3S)-1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]-1H-pyrimidin-6-one |
| SMILES | Cc1nc([C@H]2CCCN(Cc3ccccc3C(F)(F)F)C2)cc(=O)[nH]1 |
| InChI | InChI=1S/C18H20F3N3O/c1-12-22-16(9-17(25)23-12)14-6-4-8-24(11-14)10-13-5-2-3-7-15(13)18(19,20)21/h2-3,5,7,9,14H,4,6,8,10-11H2,1H3,(H,22,23,25)/t14-/m0/s1 |
| InChIKey | WFYOWYNRNFFXQH-AWEZNQCLSA-N |
| XLogP | 3.48 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |