C22H24N4O — CID 136782782
2-methyl-4-[(3S)-1-[(4-pyridin-2-ylphenyl)methyl]piperidin-3-yl]-1H-pyrimidin-6-one (PubChem CID 136782782) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-methyl-4-[(3S)-1-[(4-pyridin-2-ylphenyl)methyl]piperidin-3-yl]-1H-pyrimidin-6-one.
| Compound Name | 2-methyl-4-[(3S)-1-[(4-pyridin-2-ylphenyl)methyl]piperidin-3-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136782782 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 2-methyl-4-[(3S)-1-[(4-pyridin-2-ylphenyl)methyl]piperidin-3-yl]-1H-pyrimidin-6-one |
| SMILES | Cc1nc([C@H]2CCCN(Cc3ccc(-c4ccccn4)cc3)C2)cc(=O)[nH]1 |
| InChI | InChI=1S/C22H24N4O/c1-16-24-21(13-22(27)25-16)19-5-4-12-26(15-19)14-17-7-9-18(10-8-17)20-6-2-3-11-23-20/h2-3,6-11,13,19H,4-5,12,14-15H2,1H3,(H,24,25,27)/t19-/m0/s1 |
| InChIKey | FSJICZOSDZIJPK-IBGZPJMESA-N |
| XLogP | 3.52 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |