C20H26N4O — CID 136763695
2-methyl-4-[(3R)-1-[(4-pyrrolidin-1-ylphenyl)methyl]pyrrolidin-3-yl]-1H-pyrimidin-6-one (PubChem CID 136763695) has the molecular formula C20H26N4O and a molecular weight of 338.45 g/mol. Its IUPAC name is 2-methyl-4-[(3R)-1-[(4-pyrrolidin-1-ylphenyl)methyl]pyrrolidin-3-yl]-1H-pyrimidin-6-one.
| Compound Name | 2-methyl-4-[(3R)-1-[(4-pyrrolidin-1-ylphenyl)methyl]pyrrolidin-3-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136763695 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 2-methyl-4-[(3R)-1-[(4-pyrrolidin-1-ylphenyl)methyl]pyrrolidin-3-yl]-1H-pyrimidin-6-one |
| SMILES | Cc1nc([C@@H]2CCN(Cc3ccc(N4CCCC4)cc3)C2)cc(=O)[nH]1 |
| InChI | InChI=1S/C20H26N4O/c1-15-21-19(12-20(25)22-15)17-8-11-23(14-17)13-16-4-6-18(7-5-16)24-9-2-3-10-24/h4-7,12,17H,2-3,8-11,13-14H2,1H3,(H,21,22,25)/t17-/m1/s1 |
| InChIKey | VGSIMGXMMCTGGC-QGZVFWFLSA-N |
| XLogP | 2.67 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|