C12H16ClFN2 — CID 24904568
(3R)-1-[(3-chloro-2-fluorophenyl)methyl]piperidin-3-amine (PubChem CID 24904568) has the molecular formula C12H16ClFN2 and a molecular weight of 242.72 g/mol. Its IUPAC name is (3R)-1-[(3-chloro-2-fluorophenyl)methyl]piperidin-3-amine.
| Compound Name | (3R)-1-[(3-chloro-2-fluorophenyl)methyl]piperidin-3-amine |
|---|---|
| PubChem CID | 24904568 |
| Molecular Formula | C12H16ClFN2 |
| Molecular Weight | 242.72 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | (3R)-1-[(3-chloro-2-fluorophenyl)methyl]piperidin-3-amine |
| SMILES | N[C@@H]1CCCN(Cc2cccc(Cl)c2F)C1 |
| InChI | InChI=1S/C12H16ClFN2/c13-11-5-1-3-9(12(11)14)7-16-6-2-4-10(15)8-16/h1,3,5,10H,2,4,6-8,15H2/t10-/m1/s1 |
| InChIKey | OEWOWBWVURBHDG-SNVBAGLBSA-N |
| XLogP | 2.40 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.72 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |