C16H21ClFNO2 — CID 114489126
2-[1-[(3-chloro-2-fluorophenyl)methyl]piperidin-3-yl]-2-methylpropanoic acid (PubChem CID 114489126) has the molecular formula C16H21ClFNO2 and a molecular weight of 313.80 g/mol. Its IUPAC name is 2-[1-[(3-chloro-2-fluorophenyl)methyl]piperidin-3-yl]-2-methylpropanoic acid.
| Compound Name | 2-[1-[(3-chloro-2-fluorophenyl)methyl]piperidin-3-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 114489126 |
| Molecular Formula | C16H21ClFNO2 |
| Molecular Weight | 313.80 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2-[1-[(3-chloro-2-fluorophenyl)methyl]piperidin-3-yl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)C1CCCN(Cc2cccc(Cl)c2F)C1 |
| InChI | InChI=1S/C16H21ClFNO2/c1-16(2,15(20)21)12-6-4-8-19(10-12)9-11-5-3-7-13(17)14(11)18/h3,5,7,12H,4,6,8-10H2,1-2H3,(H,20,21) |
| InChIKey | AKBUCLUTFIDWIH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.80 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |