C17H24ClNO2 — CID 106819036
2-[1-[(3-chloro-4-methylphenyl)methyl]piperidin-3-yl]-2-methylpropanoic acid (PubChem CID 106819036) has the molecular formula C17H24ClNO2 and a molecular weight of 309.84 g/mol. Its IUPAC name is 2-[1-[(3-chloro-4-methylphenyl)methyl]piperidin-3-yl]-2-methylpropanoic acid.
| Compound Name | 2-[1-[(3-chloro-4-methylphenyl)methyl]piperidin-3-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 106819036 |
| Molecular Formula | C17H24ClNO2 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-[1-[(3-chloro-4-methylphenyl)methyl]piperidin-3-yl]-2-methylpropanoic acid |
| SMILES | Cc1ccc(CN2CCCC(C(C)(C)C(=O)O)C2)cc1Cl |
| InChI | InChI=1S/C17H24ClNO2/c1-12-6-7-13(9-15(12)18)10-19-8-4-5-14(11-19)17(2,3)16(20)21/h6-7,9,14H,4-5,8,10-11H2,1-3H3,(H,20,21) |
| InChIKey | DVPRVUJKJMOTKU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |