C13H16F4N2 — CID 107347469
2-fluoro-3-[[3-(trifluoromethyl)piperidin-1-yl]methyl]aniline (PubChem CID 107347469) has the molecular formula C13H16F4N2 and a molecular weight of 276.28 g/mol. Its IUPAC name is 2-fluoro-3-[[3-(trifluoromethyl)piperidin-1-yl]methyl]aniline.
| Compound Name | 2-fluoro-3-[[3-(trifluoromethyl)piperidin-1-yl]methyl]aniline |
|---|---|
| PubChem CID | 107347469 |
| Molecular Formula | C13H16F4N2 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 2-fluoro-3-[[3-(trifluoromethyl)piperidin-1-yl]methyl]aniline |
| SMILES | Nc1cccc(CN2CCCC(C(F)(F)F)C2)c1F |
| InChI | InChI=1S/C13H16F4N2/c14-12-9(3-1-5-11(12)18)7-19-6-2-4-10(8-19)13(15,16)17/h1,3,5,10H,2,4,6-8,18H2 |
| InChIKey | HTPKEVWRFGFGLI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|