C13H14F4N2O2 — CID 107348349
1-[(2-fluoro-3-nitrophenyl)methyl]-3-(trifluoromethyl)piperidine (PubChem CID 107348349) has the molecular formula C13H14F4N2O2 and a molecular weight of 306.26 g/mol. Its IUPAC name is 1-[(2-fluoro-3-nitrophenyl)methyl]-3-(trifluoromethyl)piperidine.
| Compound Name | 1-[(2-fluoro-3-nitrophenyl)methyl]-3-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 107348349 |
| Molecular Formula | C13H14F4N2O2 |
| Molecular Weight | 306.26 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 1-[(2-fluoro-3-nitrophenyl)methyl]-3-(trifluoromethyl)piperidine |
| SMILES | O=[N+]([O-])c1cccc(CN2CCCC(C(F)(F)F)C2)c1F |
| InChI | InChI=1S/C13H14F4N2O2/c14-12-9(3-1-5-11(12)19(20)21)7-18-6-2-4-10(8-18)13(15,16)17/h1,3,5,10H,2,4,6-8H2 |
| InChIKey | FWLDCAYQADNQKW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.26 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|